N1,N2-Dimethylcyclohexane-1,2-diamine CAS:61798-24-1
| IUPAC Name: | 1-N,2-N-dimethylcyclohexane-1,2-diamine |
| Description: | N,N’-Dimethyl-1,2-cyclohexanediamine (CAS# 61798-24-1) is used as a catalyst in the synthesis of substituted pyrazoles with anti-inflammatory activity. As well as highly functional pyridines and bipyridines. |
| Molecular Weight: | 142.24 |
| Molecular Formula: | C8H18N2 |
| Canonical SMILES: | CNC1CCCCC1NC |
| InChI: | InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3 |
| InChI Key: | JRHPOFJADXHYBR-UHFFFAOYSA-N |
| Boiling Point: | 186.8 °C at 760 mmHg |
| Density: | 0.89 g/cm3 |
| MDL: | MFCD05664382 |
| LogP: | 1.51820 |
Write your message here and send it to us
